C20H16Cl2FN3O2 — CID 118639828
(3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine]-2,4'-dione (PubChem CID 118639828) has the molecular formula C20H16Cl2FN3O2 and a molecular weight of 420.27 g/mol. Its IUPAC name is (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine]-2,4'-dione.
| Compound Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine]-2,4'-dione |
|---|---|
| PubChem CID | 118639828 |
| Molecular Formula | C20H16Cl2FN3O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)spiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine]-2,4'-dione |
| SMILES | O=C1NCC[C@@H]2N[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@@H](c3cccc(Cl)c3F)[C@H]12 |
| InChI | InChI=1S/C20H16Cl2FN3O2/c21-9-4-5-11-14(8-9)25-19(28)20(11)16(10-2-1-3-12(22)17(10)23)15-13(26-20)6-7-24-18(15)27/h1-5,8,13,15-16,26H,6-7H2,(H,24,27)(H,25,28)/t13-,15+,16-,20+/m0/s1 |
| InChIKey | AFGWMCMJZNSKKI-NCLAMWEWSA-N |
| XLogP | 3.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |