C22H20Cl2FN3O3 — CID 118439662
(3S,3'aS,6'S)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-(2-methoxyacetyl)spiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2-one (PubChem CID 118439662) has the molecular formula C22H20Cl2FN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is (3S,3'aS,6'S)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-(2-methoxyacetyl)spiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2-one.
| Compound Name | (3S,3'aS,6'S)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-(2-methoxyacetyl)spiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2-one |
|---|---|
| PubChem CID | 118439662 |
| Molecular Formula | C22H20Cl2FN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (3S,3'aS,6'S)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-(2-methoxyacetyl)spiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2-one |
| SMILES | COCC(=O)N1CC[C@@H]2N[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@@H](c3cccc(Cl)c3F)C21 |
| InChI | InChI=1S/C22H20Cl2FN3O3/c1-31-10-17(29)28-8-7-15-20(28)18(12-3-2-4-14(24)19(12)25)22(27-15)13-6-5-11(23)9-16(13)26-21(22)30/h2-6,9,15,18,20,27H,7-8,10H2,1H3,(H,26,30)/t15-,18-,20?,22+/m0/s1 |
| InChIKey | ZLDKTAHGTYLPGS-QHMIRCOASA-N |
| XLogP | 3.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |