C28H25Cl2FN4O4 — CID 129028988
methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole]-2'-yl]-3-amino-2-methoxybenzoate (PubChem CID 129028988) has the molecular formula C28H25Cl2FN4O4 and a molecular weight of 571.44 g/mol. Its IUPAC name is methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole]-2'-yl]-3-amino-2-methoxybenzoate.
| Compound Name | methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole]-2'-yl]-3-amino-2-methoxybenzoate |
|---|---|
| PubChem CID | 129028988 |
| Molecular Formula | C28H25Cl2FN4O4 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole]-2'-yl]-3-amino-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(C2C[C@@H]3N[C@@]4(C(=O)Nc5cc(Cl)ccc54)[C@@H](c4cccc(Cl)c4F)[C@@H]3N2)c(N)c1OC |
| InChI | InChI=1S/C28H25Cl2FN4O4/c1-38-25-15(26(36)39-2)8-7-13(23(25)32)18-11-20-24(33-18)21(14-4-3-5-17(30)22(14)31)28(35-20)16-9-6-12(29)10-19(16)34-27(28)37/h3-10,18,20-21,24,33,35H,11,32H2,1-2H3,(H,34,37)/t18?,20-,21-,24+,28+/m0/s1 |
| InChIKey | COHNBVBZIVCYRO-IVBPIFDBSA-N |
| XLogP | 4.52 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|