C22H17Cl2FN2O3 — CID 153063010
(3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-2,4'-dioxospiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-1'-carbaldehyde (PubChem CID 153063010) has the molecular formula C22H17Cl2FN2O3 and a molecular weight of 447.29 g/mol. Its IUPAC name is (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-2,4'-dioxospiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-1'-carbaldehyde.
| Compound Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-2,4'-dioxospiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-1'-carbaldehyde |
|---|---|
| PubChem CID | 153063010 |
| Molecular Formula | C22H17Cl2FN2O3 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (3S,3'R,3'aS,7'aS)-6-chloro-3'-(3-chloro-2-fluorophenyl)-2,4'-dioxospiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-1'-carbaldehyde |
| SMILES | O=CN1[C@H]2CCCC(=O)[C@H]2[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C22H17Cl2FN2O3/c23-11-7-8-13-15(9-11)26-21(30)22(13)19(12-3-1-4-14(24)20(12)25)18-16(27(22)10-28)5-2-6-17(18)29/h1,3-4,7-10,16,18-19H,2,5-6H2,(H,26,30)/t16-,18-,19-,22+/m0/s1 |
| InChIKey | VJURJAMLXBNUII-JLEJFLCFSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|