C19H12Cl2FN3O2 — CID 118639878
(2S,3R,3aS)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5-tetrahydropyrrolo[2,3-c]pyrrole-2,3'-1H-indole]-2',4-dione (PubChem CID 118639878) has the molecular formula C19H12Cl2FN3O2 and a molecular weight of 404.23 g/mol. Its IUPAC name is (2S,3R,3aS)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5-tetrahydropyrrolo[2,3-c]pyrrole-2,3'-1H-indole]-2',4-dione.
| Compound Name | (2S,3R,3aS)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5-tetrahydropyrrolo[2,3-c]pyrrole-2,3'-1H-indole]-2',4-dione |
|---|---|
| PubChem CID | 118639878 |
| Molecular Formula | C19H12Cl2FN3O2 |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (2S,3R,3aS)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5-tetrahydropyrrolo[2,3-c]pyrrole-2,3'-1H-indole]-2',4-dione |
| SMILES | O=C1NC=C2N[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@@H](c3cccc(Cl)c3F)[C@H]12 |
| InChI | InChI=1S/C19H12Cl2FN3O2/c20-8-4-5-10-12(6-8)24-18(27)19(10)15(9-2-1-3-11(21)16(9)22)14-13(25-19)7-23-17(14)26/h1-7,14-15,25H,(H,23,26)(H,24,27)/t14-,15+,19-/m1/s1 |
| InChIKey | ZXEWZMKSIRTEDP-ZRGWGRIASA-N |
| XLogP | 3.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |