C28H24Cl2FN3O3 — CID 118641415
(3S,3'R,3'aS,6'aR)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-pyrrolo[2,3-c]pyrrole]-2,4'-dione (PubChem CID 118641415) has the molecular formula C28H24Cl2FN3O3 and a molecular weight of 540.42 g/mol. Its IUPAC name is (3S,3'R,3'aS,6'aR)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-pyrrolo[2,3-c]pyrrole]-2,4'-dione.
| Compound Name | (3S,3'R,3'aS,6'aR)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-pyrrolo[2,3-c]pyrrole]-2,4'-dione |
|---|---|
| PubChem CID | 118641415 |
| Molecular Formula | C28H24Cl2FN3O3 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | (3S,3'R,3'aS,6'aR)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-pyrrolo[2,3-c]pyrrole]-2,4'-dione |
| SMILES | CCOc1cccc(CN2[C@H]3CNC(=O)[C@H]3[C@H](c3cccc(Cl)c3F)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C28H24Cl2FN3O3/c1-2-37-17-6-3-5-15(11-17)14-34-22-13-32-26(35)23(22)24(18-7-4-8-20(30)25(18)31)28(34)19-10-9-16(29)12-21(19)33-27(28)36/h3-12,22-24H,2,13-14H2,1H3,(H,32,35)(H,33,36)/t22-,23+,24-,28+/m0/s1 |
| InChIKey | RVSCWTMYEZULKX-NLJXWPIHSA-N |
| XLogP | 5.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |