C29H28Cl2FN3O5 — CID 157146417
2-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetaldehyde;methane (PubChem CID 157146417) has the molecular formula C29H28Cl2FN3O5 and a molecular weight of 588.46 g/mol. Its IUPAC name is 2-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetaldehyde;methane.
| Compound Name | 2-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetaldehyde;methane |
|---|---|
| PubChem CID | 157146417 |
| Molecular Formula | C29H28Cl2FN3O5 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | 2-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-[(3-ethoxyphenyl)methyl]-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetaldehyde;methane |
| SMILES | C.CCOc1cccc(CN2[C@@H](CC=O)[C@@H]([N+](=O)[O-])[C@H](c3cccc(Cl)c3F)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C28H24Cl2FN3O5.CH4/c1-2-39-18-6-3-5-16(13-18)15-33-23(11-12-35)26(34(37)38)24(19-7-4-8-21(30)25(19)31)28(33)20-10-9-17(29)14-22(20)32-27(28)36;/h3-10,12-14,23-24,26H,2,11,15H2,1H3,(H,32,36);1H4/t23-,24-,26+,28+;/m0./s1 |
| InChIKey | AKTGINDLVGDPGV-XHFXICPASA-N |
| XLogP | 6.22 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|