C30H25Cl2FN4O8 — CID 162109582
methyl 4-[2-[(2'S,3S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-3'-nitro-2-oxo-1'-propylspiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetyl]-3-nitrobenzoate (PubChem CID 162109582) has the molecular formula C30H25Cl2FN4O8 and a molecular weight of 659.45 g/mol. Its IUPAC name is methyl 4-[2-[(2'S,3S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-3'-nitro-2-oxo-1'-propylspiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetyl]-3-nitrobenzoate.
| Compound Name | methyl 4-[2-[(2'S,3S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-3'-nitro-2-oxo-1'-propylspiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 162109582 |
| Molecular Formula | C30H25Cl2FN4O8 |
| Molecular Weight | 659.45 g/mol |
| Exact Mass | 658.10 |
| IUPAC Name | methyl 4-[2-[(2'S,3S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-3'-nitro-2-oxo-1'-propylspiro[1H-indole-3,5'-pyrrolidine]-2'-yl]acetyl]-3-nitrobenzoate |
| SMILES | CCCN1[C@@H](CC(=O)c2ccc(C(=O)OC)cc2[N+](=O)[O-])C([N+](=O)[O-])[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C30H25Cl2FN4O8/c1-3-11-35-23(14-24(38)17-9-7-15(28(39)45-2)12-22(17)36(41)42)27(37(43)44)25(18-5-4-6-20(32)26(18)33)30(35)19-10-8-16(31)13-21(19)34-29(30)40/h4-10,12-13,23,25,27H,3,11,14H2,1-2H3,(H,34,40)/t23-,25-,27?,30+/m0/s1 |
| InChIKey | QMDRMAWOYJVCGV-TUINAJRYSA-N |
| XLogP | 5.77 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|