C28H19Cl2FN4O4 — CID 129264192
methyl (10S,11R,12S,14R)-6'-chloro-11-(3-chloro-2-fluorophenyl)-13-formyl-2'-oxospiro[1,8,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-12,3'-1H-indole]-5-carboxylate (PubChem CID 129264192) has the molecular formula C28H19Cl2FN4O4 and a molecular weight of 565.39 g/mol. Its IUPAC name is methyl (10S,11R,12S,14R)-6'-chloro-11-(3-chloro-2-fluorophenyl)-13-formyl-2'-oxospiro[1,8,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-12,3'-1H-indole]-5-carboxylate.
| Compound Name | methyl (10S,11R,12S,14R)-6'-chloro-11-(3-chloro-2-fluorophenyl)-13-formyl-2'-oxospiro[1,8,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-12,3'-1H-indole]-5-carboxylate |
|---|---|
| PubChem CID | 129264192 |
| Molecular Formula | C28H19Cl2FN4O4 |
| Molecular Weight | 565.39 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | methyl (10S,11R,12S,14R)-6'-chloro-11-(3-chloro-2-fluorophenyl)-13-formyl-2'-oxospiro[1,8,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-12,3'-1H-indole]-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc1n2C[C@H]2[C@@H]1[C@H](c1cccc(Cl)c1F)[C@]1(C(=O)Nc3cc(Cl)ccc31)N2C=O |
| InChI | InChI=1S/C28H19Cl2FN4O4/c1-39-26(37)13-5-8-20-19(9-13)32-25-22-21(11-34(20)25)35(12-36)28(23(22)15-3-2-4-17(30)24(15)31)16-7-6-14(29)10-18(16)33-27(28)38/h2-10,12,21-23H,11H2,1H3,(H,33,38)/t21-,22+,23-,28+/m0/s1 |
| InChIKey | JONMBRCVZGSUKO-WYNJNVBPSA-N |
| XLogP | 4.84 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|