C18H13Cl2FN4O2 — CID 118641562
(2R,3R,3aS,6aR)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2,3'-1H-pyrrolo[2,3-b]pyridine]-2',4-dione (PubChem CID 118641562) has the molecular formula C18H13Cl2FN4O2 and a molecular weight of 407.23 g/mol. Its IUPAC name is (2R,3R,3aS,6aR)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2,3'-1H-pyrrolo[2,3-b]pyridine]-2',4-dione.
| Compound Name | (2R,3R,3aS,6aR)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2,3'-1H-pyrrolo[2,3-b]pyridine]-2',4-dione |
|---|---|
| PubChem CID | 118641562 |
| Molecular Formula | C18H13Cl2FN4O2 |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (2R,3R,3aS,6aR)-6'-chloro-3-(3-chloro-2-fluorophenyl)spiro[1,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2,3'-1H-pyrrolo[2,3-b]pyridine]-2',4-dione |
| SMILES | O=C1NC[C@@H]2N[C@]3(C(=O)Nc4nc(Cl)ccc43)[C@@H](c3cccc(Cl)c3F)[C@H]12 |
| InChI | InChI=1S/C18H13Cl2FN4O2/c19-9-3-1-2-7(14(9)21)13-12-10(6-22-16(12)26)25-18(13)8-4-5-11(20)23-15(8)24-17(18)27/h1-5,10,12-13,25H,6H2,(H,22,26)(H,23,24,27)/t10-,12+,13-,18-/m0/s1 |
| InChIKey | WEXYBSSUZMDTED-UQGFQMMYSA-N |
| XLogP | 2.18 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|