C21H19Cl2FN4O4 — CID 130376385
(3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one (PubChem CID 130376385) has the molecular formula C21H19Cl2FN4O4 and a molecular weight of 481.31 g/mol. Its IUPAC name is (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 130376385 |
| Molecular Formula | C21H19Cl2FN4O4 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2nc(Cl)ccc2[C@@]12[C@@H](c1cccc(Cl)c1F)[C@H]([N+](=O)[O-])[C@H](CO)N2CC1CC1 |
| InChI | InChI=1S/C21H19Cl2FN4O4/c22-13-3-1-2-11(17(13)24)16-18(28(31)32)14(9-29)27(8-10-4-5-10)21(16)12-6-7-15(23)25-19(12)26-20(21)30/h1-3,6-7,10,14,16,18,29H,4-5,8-9H2,(H,25,26,30)/t14-,16-,18+,21+/m0/s1 |
| InChIKey | RJUDTKUNRCYYPJ-XYPVVTQSSA-N |
| XLogP | 3.19 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|