C22H21Cl2FN4O4 — CID 118439512
(3S,3'S,4'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one (PubChem CID 118439512) has the molecular formula C22H21Cl2FN4O4 and a molecular weight of 495.34 g/mol. Its IUPAC name is (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 118439512 |
| Molecular Formula | C22H21Cl2FN4O4 |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2nc(Cl)ccc2[C@@]12[C@@H](c1cccc(Cl)c1F)[C@H]([N+](=O)[O-])[C@H](CCO)N2CC1CC1 |
| InChI | InChI=1S/C22H21Cl2FN4O4/c23-14-3-1-2-12(18(14)25)17-19(29(32)33)15(8-9-30)28(10-11-4-5-11)22(17)13-6-7-16(24)26-20(13)27-21(22)31/h1-3,6-7,11,15,17,19,30H,4-5,8-10H2,(H,26,27,31)/t15-,17-,19+,22+/m0/s1 |
| InChIKey | WSIIONPHIXDAMQ-RNCHUUSHSA-N |
| XLogP | 3.58 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|