About CID 89051482
CID 89051482 (PubChem CID 89051482) has the molecular formula C31H37Cl2FN4O5
and a molecular weight of 635.56 g/mol.
Molecular Properties
| Compound Name | CID 89051482 |
| PubChem CID | 89051482 |
| Molecular Formula | C31H37Cl2FN4O5 |
| Molecular Weight | 635.56 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1C[C@@H](NC(=O)[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4nc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CO[C@@H]1CO |
| InChI | InChI=1S/C31H37Cl2FN4O5/c1-29(2)9-11-30(12-10-29)31(18-7-8-22(33)36-26(18)37-28(31)41)23(17-5-4-6-19(32)24(17)34)25(38-30)27(40)35-16-13-20(42-3)21(14-39)43-15-16/h4-8,16,20-21,23,25,38-39H,9-15H2,1-3H3,(H,35,40)(H,36,37,41)/t16-,20-,21-,23+,25-,31-/m1/s1 |
| InChIKey | XPICDZVSPADXNQ-FMFCOYIDSA-N |
| XLogP | 4.09 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze CID 89051482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89051482?
The IUPAC name of CID 89051482 (CID 89051482) is not available.
What is the SMILES notation for CID 89051482?
The canonical SMILES for CID 89051482 is CO[C@@H]1C[C@@H](NC(=O)[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4nc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CO[C@@H]1CO.
What is the InChIKey of CID 89051482?
The InChIKey is XPICDZVSPADXNQ-FMFCOYIDSA-N. The full InChI is InChI=1S/C31H37Cl2FN4O5/c1-29(2)9-11-30(12-10-29)31(18-7-8-22(33)36-26(18)37-28(31)41)23(17-5-4-6-19(32)24(17)34)25(38-30)27(40)35-16-13-20(42-3)21(14-39)43-15-16/h4-8,16,20-21,23,25,38-39H,9-15H2,1-3H3,(H,35,40)(H,36,37,41)/t16-,20-,21-,23+,25-,31-/m1/s1.
What are the key properties of CID 89051482?
CID 89051482 has a molecular weight of 635.56 g/mol, XLogP of 4.09, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89051482 is sourced from PubChem (CID 89051482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).