C33H38Cl2FN5O4 — CID 88931753
CID 88931753 (PubChem CID 88931753) has the molecular formula C33H38Cl2FN5O4 and a molecular weight of 658.60 g/mol.
| Compound Name | CID 88931753 |
|---|---|
| PubChem CID | 88931753 |
| Molecular Formula | C33H38Cl2FN5O4 |
| Molecular Weight | 658.60 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)N[C@@H]1CC[C@@H](C(=O)NC3CC3)OC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C33H38Cl2FN5O4/c1-31(2)10-12-32(13-11-31)33(21-7-3-17(34)15-22(21)40-30(33)44)24(20-9-14-37-27(35)25(20)36)26(41-32)29(43)39-19-6-8-23(45-16-19)28(42)38-18-4-5-18/h3,7,9,14-15,18-19,23-24,26,41H,4-6,8,10-13,16H2,1-2H3,(H,38,42)(H,39,43)(H,40,44)/t19-,23+,24+,26-,33-/m1/s1 |
| InChIKey | RJPSYNPXBBHVII-MHECCOITSA-N |
| XLogP | 4.75 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|