C33H40Cl2FN5O4 — CID 89051432
CID 89051432 (PubChem CID 89051432) has the molecular formula C33H40Cl2FN5O4 and a molecular weight of 660.62 g/mol.
| Compound Name | CID 89051432 |
|---|---|
| PubChem CID | 89051432 |
| Molecular Formula | C33H40Cl2FN5O4 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | — |
| SMILES | CCN(C)C(=O)[C@@H]1CC[C@@H](NC(=O)[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)CO1 |
| InChI | InChI=1S/C33H40Cl2FN5O4/c1-5-41(4)29(43)23-9-7-19(17-45-23)38-28(42)26-24(20-10-15-37-27(35)25(20)36)33(32(40-26)13-11-31(2,3)12-14-32)21-8-6-18(34)16-22(21)39-30(33)44/h6,8,10,15-16,19,23-24,26,40H,5,7,9,11-14,17H2,1-4H3,(H,38,42)(H,39,44)/t19-,23+,24+,26-,33-/m1/s1 |
| InChIKey | VZQUZQSIUFRCPD-MHECCOITSA-N |
| XLogP | 4.95 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|