C30H37Cl2FN8O2 — CID 134289670
CID 134289670 (PubChem CID 134289670) has the molecular formula C30H37Cl2FN8O2 and a molecular weight of 631.58 g/mol.
| Compound Name | CID 134289670 |
|---|---|
| PubChem CID | 134289670 |
| Molecular Formula | C30H37Cl2FN8O2 |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)NC1CCN(/C(N)=N/N)CC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C30H37Cl2FN8O2/c1-28(2)8-10-29(11-9-28)30(19-4-3-16(31)15-20(19)38-26(30)43)21(18-5-12-36-24(32)22(18)33)23(39-29)25(42)37-17-6-13-41(14-7-17)27(34)40-35/h3-5,12,15,17,21,23,39H,6-11,13-14,35H2,1-2H3,(H2,34,40)(H,37,42)(H,38,43)/t21-,23+,30+/m0/s1 |
| InChIKey | ZNWLOLZQOCQRQF-YXACEECVSA-N |
| XLogP | 3.58 |
| TPSA | 150.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|