C31H37Cl2FN4O5 — CID 89051519
CID 89051519 (PubChem CID 89051519) has the molecular formula C31H37Cl2FN4O5 and a molecular weight of 635.56 g/mol.
| Compound Name | CID 89051519 |
|---|---|
| PubChem CID | 89051519 |
| Molecular Formula | C31H37Cl2FN4O5 |
| Molecular Weight | 635.56 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@H](NC(=O)[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)CO[C@@H]1CO |
| InChI | InChI=1S/C31H37Cl2FN4O5/c1-29(2)7-9-30(10-8-29)31(19-5-4-16(32)12-20(19)37-28(31)41)23(18-6-11-35-26(33)24(18)34)25(38-30)27(40)36-17-13-21(42-3)22(14-39)43-15-17/h4-6,11-12,17,21-23,25,38-39H,7-10,13-15H2,1-3H3,(H,36,40)(H,37,41)/t17-,21+,22-,23+,25-,31-/m1/s1 |
| InChIKey | HCPBKNLYFBJQHM-CTGWGAJJSA-N |
| XLogP | 4.09 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|