C30H37Cl3FN5O5 — CID 141460490
CID 141460490 (PubChem CID 141460490) has the molecular formula C30H37Cl3FN5O5 and a molecular weight of 673.01 g/mol.
| Compound Name | CID 141460490 |
|---|---|
| PubChem CID | 141460490 |
| Molecular Formula | C30H37Cl3FN5O5 |
| Molecular Weight | 673.01 g/mol |
| Exact Mass | 671.18 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)N[C@@H]1CC[C@@H](C(N)=O)OC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21.Cl.O |
| InChI | InChI=1S/C30H34Cl2FN5O4.ClH.H2O/c1-28(2)8-10-29(11-9-28)30(18-5-3-15(31)13-19(18)37-27(30)41)21(17-7-12-35-24(32)22(17)33)23(38-29)26(40)36-16-4-6-20(25(34)39)42-14-16;;/h3,5,7,12-13,16,20-21,23,38H,4,6,8-11,14H2,1-2H3,(H2,34,39)(H,36,40)(H,37,41);1H;1H2/t16-,20+,21+,23-,30-;;/m1../s1 |
| InChIKey | FEVTXDMNDPPQRO-CIPNXXNHSA-N |
| XLogP | 3.56 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.01 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|