C35H44Cl2FN5O4 — CID 166753026
CID 166753026 (PubChem CID 166753026) has the molecular formula C35H44Cl2FN5O4 and a molecular weight of 688.67 g/mol.
| Compound Name | CID 166753026 |
|---|---|
| PubChem CID | 166753026 |
| Molecular Formula | C35H44Cl2FN5O4 |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)NC1CCN(CC(=O)OC(C)(C)C)CC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C35H44Cl2FN5O4/c1-32(2,3)47-25(44)19-43-16-9-21(10-17-43)40-30(45)28-26(22-8-15-39-29(37)27(22)38)35(34(42-28)13-11-33(4,5)12-14-34)23-7-6-20(36)18-24(23)41-31(35)46/h6-8,15,18,21,26,28,42H,9-14,16-17,19H2,1-5H3,(H,40,45)(H,41,46)/t26-,28+,35+/m0/s1 |
| InChIKey | BXHDUGWEGKOUQU-HMFZJFDYSA-N |
| XLogP | 5.73 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|