C32H42Cl2FN5O8S — CID 86672602
SCHEMBL13276036 (PubChem CID 86672602) has the molecular formula C32H42Cl2FN5O8S and a molecular weight of 746.69 g/mol.
| Compound Name | SCHEMBL13276036 |
|---|---|
| PubChem CID | 86672602 |
| Molecular Formula | C32H42Cl2FN5O8S |
| Molecular Weight | 746.69 g/mol |
| Exact Mass | 745.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)N[C@@H]1CC[C@@H](C(N)=O)OC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21.CCS(=O)(=O)O.O |
| InChI | InChI=1S/C30H34Cl2FN5O4.C2H6O3S.H2O/c1-28(2)8-10-29(11-9-28)30(18-5-3-15(31)13-19(18)37-27(30)41)21(17-7-12-35-24(32)22(17)33)23(38-29)26(40)36-16-4-6-20(25(34)39)42-14-16;1-2-6(3,4)5;/h3,5,7,12-13,16,20-21,23,38H,4,6,8-11,14H2,1-2H3,(H2,34,39)(H,36,40)(H,37,41);2H2,1H3,(H,3,4,5);1H2/t16-,20+,21+,23-,30-;;/m1../s1 |
| InChIKey | PNKIGFQIMQPXDO-CIPNXXNHSA-N |
| XLogP | 3.03 |
| TPSA | 221.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|