C31H36Cl2FN3O2 — CID 171053366
CID 171053366 (PubChem CID 171053366) has the molecular formula C31H36Cl2FN3O2 and a molecular weight of 572.55 g/mol.
| Compound Name | CID 171053366 |
|---|---|
| PubChem CID | 171053366 |
| Molecular Formula | C31H36Cl2FN3O2 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | — |
| SMILES | CCC1CCC(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C31H36Cl2FN3O2/c1-2-18-9-12-20(13-10-18)35-28(38)27-25(21-7-6-8-23(33)26(21)34)31(30(37-27)15-4-3-5-16-30)22-14-11-19(32)17-24(22)36-29(31)39/h6-8,11,14,17-18,20,25,27,37H,2-5,9-10,12-13,15-16H2,1H3,(H,35,38)(H,36,39)/t18?,20?,25-,27+,31+/m0/s1 |
| InChIKey | GQLVLGQCQKLAAX-YOHBTLJGSA-N |
| XLogP | 6.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |