C29H32ClFIN3O3 — CID 70913811
CID 70913811 (PubChem CID 70913811) has the molecular formula C29H32ClFIN3O3 and a molecular weight of 651.95 g/mol.
| Compound Name | CID 70913811 |
|---|---|
| PubChem CID | 70913811 |
| Molecular Formula | C29H32ClFIN3O3 |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | — |
| SMILES | O=C(NC1CCC(O)CC1)[C@@H]1NC2(CCCCC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(I)c1F |
| InChI | InChI=1S/C29H32ClFIN3O3/c30-16-7-12-20-22(15-16)34-27(38)29(20)23(19-5-4-6-21(32)24(19)31)25(35-28(29)13-2-1-3-14-28)26(37)33-17-8-10-18(36)11-9-17/h4-7,12,15,17-18,23,25,35-36H,1-3,8-11,13-14H2,(H,33,37)(H,34,38)/t17?,18?,23-,25+,29+/m0/s1 |
| InChIKey | LTUUQWARMCGVMP-DJUSMVAGSA-N |
| XLogP | 5.15 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|