C29H30Cl2F3N3O2 — CID 134289571
CID 134289571 (PubChem CID 134289571) has the molecular formula C29H30Cl2F3N3O2 and a molecular weight of 580.48 g/mol.
| Compound Name | CID 134289571 |
|---|---|
| PubChem CID | 134289571 |
| Molecular Formula | C29H30Cl2F3N3O2 |
| Molecular Weight | 580.48 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | — |
| SMILES | O=C(NC1CCCCC1)[C@@H]1NC2(CC(CF)(CF)C2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C29H30Cl2F3N3O2/c30-16-9-10-19-21(11-16)36-26(39)29(19)22(18-7-4-8-20(31)23(18)34)24(25(38)35-17-5-2-1-3-6-17)37-28(29)12-27(13-28,14-32)15-33/h4,7-11,17,22,24,37H,1-3,5-6,12-15H2,(H,35,38)(H,36,39)/t22-,24+,29+/m0/s1 |
| InChIKey | ZVZCZQWVRPGPAX-IQANXLHVSA-N |
| XLogP | 5.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |