C32H35ClF3IN4O3 — CID 70913960
CID 70913960 (PubChem CID 70913960) has the molecular formula C32H35ClF3IN4O3 and a molecular weight of 743.01 g/mol.
| Compound Name | CID 70913960 |
|---|---|
| PubChem CID | 70913960 |
| Molecular Formula | C32H35ClF3IN4O3 |
| Molecular Weight | 743.01 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)C1CCC(NC(=O)[C@@H]2NC3(CC(CF)(CF)C3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cc(F)cc(I)c2)CC1 |
| InChI | InChI=1S/C32H35ClF3IN4O3/c1-41(2)28(43)17-3-6-22(7-4-17)38-27(42)26-25(18-9-20(36)12-21(37)10-18)32(31(40-26)13-30(14-31,15-34)16-35)23-8-5-19(33)11-24(23)39-29(32)44/h5,8-12,17,22,25-26,40H,3-4,6-7,13-16H2,1-2H3,(H,38,42)(H,39,44)/t17?,22?,25-,26+,32+/m0/s1 |
| InChIKey | ATNQDSSEEQTPNA-KULUTKKOSA-N |
| XLogP | 5.25 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.01 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|