C32H38Cl2FN5O3 — CID 134289484
CID 134289484 (PubChem CID 134289484) has the molecular formula C32H38Cl2FN5O3 and a molecular weight of 630.59 g/mol.
| Compound Name | CID 134289484 |
|---|---|
| PubChem CID | 134289484 |
| Molecular Formula | C32H38Cl2FN5O3 |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)C1CC(NC(=O)C[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)C1 |
| InChI | InChI=1S/C32H38Cl2FN5O3/c1-30(2)8-10-31(11-9-30)32(21-6-5-18(33)15-22(21)38-29(32)43)25(20-7-12-36-27(34)26(20)35)23(39-31)16-24(41)37-19-13-17(14-19)28(42)40(3)4/h5-7,12,15,17,19,23,25,39H,8-11,13-14,16H2,1-4H3,(H,37,41)(H,38,43)/t17?,19?,23-,25-,32+/m0/s1 |
| InChIKey | OWLYZYAZRZFFGK-UCMYFBOHSA-N |
| XLogP | 5.19 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|