C31H35Cl2F3N4O4 — CID 167005695
CID 167005695 (PubChem CID 167005695) has the molecular formula C31H35Cl2F3N4O4 and a molecular weight of 655.55 g/mol.
| Compound Name | CID 167005695 |
|---|---|
| PubChem CID | 167005695 |
| Molecular Formula | C31H35Cl2F3N4O4 |
| Molecular Weight | 655.55 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | — |
| SMILES | C=C(Cl)/C=C\C=C(/F)[C@H]1[C@H](C(=O)N[C@@H]2CC[C@@H](C(=O)NCC)OC2)NC2(CC(CF)(CF)C2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H35Cl2F3N4O4/c1-3-37-26(41)23-10-8-19(12-44-23)38-27(42)25-24(21(36)6-4-5-17(2)32)31(30(40-25)13-29(14-30,15-34)16-35)20-9-7-18(33)11-22(20)39-28(31)43/h4-7,9,11,19,23-25,40H,2-3,8,10,12-16H2,1H3,(H,37,41)(H,38,42)(H,39,43)/b5-4-,21-6-/t19-,23+,24+,25-,31-/m1/s1 |
| InChIKey | YQEMZMJTOZRNCO-LKGLGSLBSA-N |
| XLogP | 4.54 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|