C24H22Cl2N2O4 — CID 67999286
2-[(3R,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxospiro[1H-indole-3,6'-piperidine]-3'-yl]acetic acid (PubChem CID 67999286) has the molecular formula C24H22Cl2N2O4 and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-[(3R,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxospiro[1H-indole-3,6'-piperidine]-3'-yl]acetic acid.
| Compound Name | 2-[(3R,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxospiro[1H-indole-3,6'-piperidine]-3'-yl]acetic acid |
|---|---|
| PubChem CID | 67999286 |
| Molecular Formula | C24H22Cl2N2O4 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[(3R,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxospiro[1H-indole-3,6'-piperidine]-3'-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1C[C@H](c2cccc(Cl)c2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)N(CC2CC2)C1=O |
| InChI | InChI=1S/C24H22Cl2N2O4/c25-16-3-1-2-14(8-16)19-9-15(10-21(29)30)22(31)28(12-13-4-5-13)24(19)18-7-6-17(26)11-20(18)27-23(24)32/h1-3,6-8,11,13,15,19H,4-5,9-10,12H2,(H,27,32)(H,29,30)/t15-,19-,24+/m1/s1 |
| InChIKey | BJYAVSZQIJEQQR-JLCUDIMXSA-N |
| XLogP | 4.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |