C30H36Cl2N2O5Si — CID 58573626
2-[(3S,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,6'-piperidine]-3'-yl]acetic acid (PubChem CID 58573626) has the molecular formula C30H36Cl2N2O5Si and a molecular weight of 603.62 g/mol. Its IUPAC name is 2-[(3S,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,6'-piperidine]-3'-yl]acetic acid.
| Compound Name | 2-[(3S,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,6'-piperidine]-3'-yl]acetic acid |
|---|---|
| PubChem CID | 58573626 |
| Molecular Formula | C30H36Cl2N2O5Si |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-[(3S,3'R,5'R)-6-chloro-5'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-2,2'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,6'-piperidine]-3'-yl]acetic acid |
| SMILES | C[Si](C)(C)CCOCN1C(=O)[C@@]2(c3ccc(Cl)cc31)[C@@H](c1cccc(Cl)c1)C[C@H](CC(=O)O)C(=O)N2CC1CC1 |
| InChI | InChI=1S/C30H36Cl2N2O5Si/c1-40(2,3)12-11-39-18-33-26-16-23(32)9-10-24(26)30(29(33)38)25(20-5-4-6-22(31)13-20)14-21(15-27(35)36)28(37)34(30)17-19-7-8-19/h4-6,9-10,13,16,19,21,25H,7-8,11-12,14-15,17-18H2,1-3H3,(H,35,36)/t21-,25-,30-/m1/s1 |
| InChIKey | NGLQSUAVKOBYRC-WIISGGPLSA-N |
| XLogP | 6.36 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|