C35H39Cl2FN2O6Si — CID 59419603
2-[4-chloro-2-[(2'S,3S,4'R)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,3'-piperidine]-4'-yl]phenoxy]-2-methylpropanoic acid (PubChem CID 59419603) has the molecular formula C35H39Cl2FN2O6Si and a molecular weight of 701.69 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2'S,3S,4'R)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,3'-piperidine]-4'-yl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-chloro-2-[(2'S,3S,4'R)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,3'-piperidine]-4'-yl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59419603 |
| Molecular Formula | C35H39Cl2FN2O6Si |
| Molecular Weight | 701.69 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | 2-[4-chloro-2-[(2'S,3S,4'R)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxo-1-(2-trimethylsilylethoxymethyl)spiro[indole-3,3'-piperidine]-4'-yl]phenoxy]-2-methylpropanoic acid |
| SMILES | Cc1ccc(F)cc1[C@@H]1NC(=O)C[C@H](c2cc(Cl)ccc2OC(C)(C)C(=O)O)[C@@]12C(=O)N(COCC[Si](C)(C)C)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C35H39Cl2FN2O6Si/c1-20-7-10-23(38)17-24(20)31-35(26-11-8-22(37)16-28(26)40(32(35)42)19-45-13-14-47(4,5)6)27(18-30(41)39-31)25-15-21(36)9-12-29(25)46-34(2,3)33(43)44/h7-12,15-17,27,31H,13-14,18-19H2,1-6H3,(H,39,41)(H,43,44)/t27-,31+,35-/m1/s1 |
| InChIKey | XHHAGKGPTBTOAX-CJSQLPAHSA-N |
| XLogP | 7.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|