C26H21N3O3 — CID 72734833
CID 72734833 (PubChem CID 72734833) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol.
| Compound Name | CID 72734833 |
|---|---|
| PubChem CID | 72734833 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@@H]1[C@]2(C(=O)Nc3ccccc32)[C@H](c2ccccc2)N[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C26H21N3O3/c1-15(30)21-25(17-11-5-7-13-19(17)27-23(25)31)22(16-9-3-2-4-10-16)29-26(21)18-12-6-8-14-20(18)28-24(26)32/h2-14,21-22,29H,1H3,(H,27,31)(H,28,32)/t21-,22+,25+,26-/m1/s1 |
| InChIKey | FBXQDSRAMODHPI-FIKUDORNSA-N |
| XLogP | 3.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |