About 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide
5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide (PubChem CID 75950163) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide.
Molecular Properties
| Compound Name | 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide |
| PubChem CID | 75950163 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide |
| SMILES | CC(C)CC1CC(C(=O)Nc2ccccc2)C2(N1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c1-14(2)12-16-13-18(20(26)23-15-8-4-3-5-9-15)22(25-16)17-10-6-7-11-19(17)24-21(22)27/h3-11,14,16,18,25H,12-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | DJEMZBJTEDYTBT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide?
The IUPAC name of 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide (CID 75950163) is 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide.
What is the SMILES notation for 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide?
The canonical SMILES for 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide is CC(C)CC1CC(C(=O)Nc2ccccc2)C2(N1)C(=O)Nc1ccccc12.
What is the InChIKey of 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide?
The InChIKey is DJEMZBJTEDYTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c1-14(2)12-16-13-18(20(26)23-15-8-4-3-5-9-15)22(25-16)17-10-6-7-11-19(17)24-21(22)27/h3-11,14,16,18,25H,12-13H2,1-2H3,(H,23,26)(H,24,27).
What are the key properties of 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide?
5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide has a molecular weight of 363.46 g/mol, XLogP of 3.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-(2-methylpropyl)-2-oxo-N-phenylspiro[1H-indole-3,2'-pyrrolidine]-3'-carboxamide is sourced from PubChem (CID 75950163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).