C18H17N3O2 — CID 123527468
2-oxo-N-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 123527468) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-oxo-N-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | 2-oxo-N-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 123527468 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-oxo-N-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CC2(CN1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H17N3O2/c22-16(20-12-6-2-1-3-7-12)15-10-18(11-19-15)13-8-4-5-9-14(13)21-17(18)23/h1-9,15,19H,10-11H2,(H,20,22)(H,21,23) |
| InChIKey | LLOGZQSLKLYVPN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |