C12H13N3O2 — CID 175928748
5-deuterio-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 175928748) has the molecular formula C12H13N3O2 and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-deuterio-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | 5-deuterio-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 175928748 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-deuterio-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | [2H]c1ccc2c(c1)C1(CNC(C(N)=O)C1)C(=O)N2 |
| InChI | InChI=1S/C12H13N3O2/c13-10(16)9-5-12(6-14-9)7-3-1-2-4-8(7)15-11(12)17/h1-4,9,14H,5-6H2,(H2,13,16)(H,15,17)/i1D |
| InChIKey | XUYLQSPCFOVCBQ-MICDWDOJSA-N |
| XLogP | -0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |