C25H20Cl2N2O3 — CID 45490042
methyl (2'R,3S,3'R,5'S)-5'-(2,3-dichlorophenyl)-2-oxo-3'-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 45490042) has the molecular formula C25H20Cl2N2O3 and a molecular weight of 467.35 g/mol. Its IUPAC name is methyl (2'R,3S,3'R,5'S)-5'-(2,3-dichlorophenyl)-2-oxo-3'-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | methyl (2'R,3S,3'R,5'S)-5'-(2,3-dichlorophenyl)-2-oxo-3'-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 45490042 |
| Molecular Formula | C25H20Cl2N2O3 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | methyl (2'R,3S,3'R,5'S)-5'-(2,3-dichlorophenyl)-2-oxo-3'-phenylspiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2cccc(Cl)c2Cl)[C@]2(C(=O)Nc3ccccc32)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N2O3/c1-32-23(30)21-19(14-8-3-2-4-9-14)25(16-11-5-6-13-18(16)28-24(25)31)22(29-21)15-10-7-12-17(26)20(15)27/h2-13,19,21-22,29H,1H3,(H,28,31)/t19-,21+,22+,25+/m0/s1 |
| InChIKey | PAGTVEWQLNESRD-SCIUHPPWSA-N |
| XLogP | 4.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |