C30H28N2O5 — CID 23245822
2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-5'-(2,2-diphenylethenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2',3'-dicarboxylate (PubChem CID 23245822) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-5'-(2,2-diphenylethenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2',3'-dicarboxylate.
| Compound Name | 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-5'-(2,2-diphenylethenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2',3'-dicarboxylate |
|---|---|
| PubChem CID | 23245822 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-O'-ethyl 3-O'-methyl (2'S,3R,3'S,5'S)-5'-(2,2-diphenylethenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2',3'-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](C=C(c2ccccc2)c2ccccc2)[C@@]2(C(=O)Nc3ccccc32)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C30H28N2O5/c1-3-37-28(34)26-25(27(33)36-2)30(22-16-10-11-17-23(22)31-29(30)35)24(32-26)18-21(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-18,24-26,32H,3H2,1-2H3,(H,31,35)/t24-,25-,26-,30+/m0/s1 |
| InChIKey | NESICAIEQHVPAJ-VWDBNSKXSA-N |
| XLogP | 3.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |