C18H19NO4 — CID 102597403
ethyl (1'R,2'R,3S,4'R)-2,6'-dioxospiro[1H-indole-3,3'-bicyclo[2.2.2]octane]-2'-carboxylate (PubChem CID 102597403) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl (1'R,2'R,3S,4'R)-2,6'-dioxospiro[1H-indole-3,3'-bicyclo[2.2.2]octane]-2'-carboxylate.
| Compound Name | ethyl (1'R,2'R,3S,4'R)-2,6'-dioxospiro[1H-indole-3,3'-bicyclo[2.2.2]octane]-2'-carboxylate |
|---|---|
| PubChem CID | 102597403 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl (1'R,2'R,3S,4'R)-2,6'-dioxospiro[1H-indole-3,3'-bicyclo[2.2.2]octane]-2'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@H](CC2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H19NO4/c1-2-23-16(21)15-11-8-7-10(9-14(11)20)18(15)12-5-3-4-6-13(12)19-17(18)22/h3-6,10-11,15H,2,7-9H2,1H3,(H,19,22)/t10-,11+,15+,18-/m1/s1 |
| InChIKey | PYNJRWUMFKKCML-MZZIBZEXSA-N |
| XLogP | 2.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |