C33H26FN3O6 — CID 52941653
CID 52941653 (PubChem CID 52941653) has the molecular formula C33H26FN3O6 and a molecular weight of 579.58 g/mol.
| Compound Name | CID 52941653 |
|---|---|
| PubChem CID | 52941653 |
| Molecular Formula | C33H26FN3O6 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccc(F)cc2)C(c2ccccc2)NC12C(=O)Nc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C33H26FN3O6/c1-42-26-14-20-17-32(30(38)23(20)16-27(26)43-2)28(18-8-10-21(34)11-9-18)29(19-6-4-3-5-7-19)36-33(32)24-15-22(37(40)41)12-13-25(24)35-31(33)39/h3-16,28-29,36H,17H2,1-2H3,(H,35,39) |
| InChIKey | SPVLXLKDUQTNJT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|