C31H30N2O6S — CID 57399331
CID 57399331 (PubChem CID 57399331) has the molecular formula C31H30N2O6S and a molecular weight of 558.66 g/mol.
| Compound Name | CID 57399331 |
|---|---|
| PubChem CID | 57399331 |
| Molecular Formula | C31H30N2O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2C3CSCN3C3(C(=O)Nc4ccccc43)C23Cc2cc(OC)c(OC)cc2C3=O)cc1OC |
| InChI | InChI=1S/C31H30N2O6S/c1-36-23-10-9-17(11-24(23)37-2)27-22-15-40-16-33(22)31(20-7-5-6-8-21(20)32-29(31)35)30(27)14-18-12-25(38-3)26(39-4)13-19(18)28(30)34/h5-13,22,27H,14-16H2,1-4H3,(H,32,35) |
| InChIKey | FAYAYZMIJPEAGR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |