C28H22N2O3S — CID 52946162
(5'R,7'R,7a'R)-7'-(2-Methylphenyl)-7',7a'-dihydro-1'H-dispiro[indene-2,6'-pyrrolo[1,2-c][1,3]thiazole-5',3''-indole]-1,2'',3(1''H)-trione (PubChem CID 52946162) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol.
| Compound Name | (5'R,7'R,7a'R)-7'-(2-Methylphenyl)-7',7a'-dihydro-1'H-dispiro[indene-2,6'-pyrrolo[1,2-c][1,3]thiazole-5',3''-indole]-1,2'',3(1''H)-trione |
|---|---|
| PubChem CID | 52946162 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CSCN2[C@@]2(C(=O)Nc3ccccc32)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H22N2O3S/c1-16-8-2-3-9-17(16)23-22-14-34-15-30(22)28(20-12-6-7-13-21(20)29-26(28)33)27(23)24(31)18-10-4-5-11-19(18)25(27)32/h2-13,22-23H,14-15H2,1H3,(H,29,33)/t22-,23-,28-/m0/s1 |
| InChIKey | FAHOBWWZJZJNNG-LXWOLXCRSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|