C29H23Cl2N5O2S — CID 177417934
CID 177417934 (PubChem CID 177417934) has the molecular formula C29H23Cl2N5O2S and a molecular weight of 576.51 g/mol.
| Compound Name | CID 177417934 |
|---|---|
| PubChem CID | 177417934 |
| Molecular Formula | C29H23Cl2N5O2S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | — |
| SMILES | Cc1[nH]nc2nc3c(cc12)C(=O)[C@]1(CC3)[C@@H](c2ccc(Cl)cc2Cl)C2CSCN2[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H23Cl2N5O2S/c1-14-17-11-18-21(32-26(17)35-34-14)8-9-28(25(18)37)24(16-7-6-15(30)10-20(16)31)23-12-39-13-36(23)29(28)19-4-2-3-5-22(19)33-27(29)38/h2-7,10-11,23-24H,8-9,12-13H2,1H3,(H,33,38)(H,32,34,35)/t23?,24-,28-,29-/m0/s1 |
| InChIKey | IPVZEPCCZVGOCT-MYMZMHOMSA-N |
| XLogP | 5.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |