C33H32N4O4S — CID 46228386
CID 46228386 (PubChem CID 46228386) has the molecular formula C33H32N4O4S and a molecular weight of 580.71 g/mol.
| Compound Name | CID 46228386 |
|---|---|
| PubChem CID | 46228386 |
| Molecular Formula | C33H32N4O4S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1/C=C1\CN(C)C[C@@]2(C1=O)[C@H](c1ccccc1C)[C@@H]1CSCN1[C@@]21C(=O)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C33H32N4O4S/c1-20-8-4-6-10-22(20)14-23-16-35(3)18-32(30(23)38)29(25-11-7-5-9-21(25)2)28-17-42-19-36(28)33(32)26-15-24(37(40)41)12-13-27(26)34-31(33)39/h4-15,28-29H,16-19H2,1-3H3,(H,34,39)/b23-14+/t28-,29+,32-,33-/m0/s1 |
| InChIKey | YKPAFORHNSIFOH-SFJPHYQLSA-N |
| XLogP | 5.12 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|