C27H18BrClN2O3S — CID 52942762
(5'R,7'S,7a'R)-7'-(2-Bromophenyl)-5''-chloro-7',7a'-dihydro-1'H-dispiro[indene-2,6'-pyrrolo[1,2-c][1,3]thiazole-5',3''-indole]-1,2'',3(1''H)-trione (PubChem CID 52942762) has the molecular formula C27H18BrClN2O3S and a molecular weight of 565.88 g/mol.
| Compound Name | (5'R,7'S,7a'R)-7'-(2-Bromophenyl)-5''-chloro-7',7a'-dihydro-1'H-dispiro[indene-2,6'-pyrrolo[1,2-c][1,3]thiazole-5',3''-indole]-1,2'',3(1''H)-trione |
|---|---|
| PubChem CID | 52942762 |
| Molecular Formula | C27H18BrClN2O3S |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12[C@@H](c1ccccc1Br)[C@@H]1CSCN1[C@@]21C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C27H18BrClN2O3S/c28-19-8-4-3-7-17(19)22-21-12-35-13-31(21)27(18-11-14(29)9-10-20(18)30-25(27)34)26(22)23(32)15-5-1-2-6-16(15)24(26)33/h1-11,21-22H,12-13H2,(H,30,34)/t21-,22-,27-/m0/s1 |
| InChIKey | ONCURHDREMDJMN-BERHBOFZSA-N |
| XLogP | 5.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|