C33H33N3O2 — CID 171346236
CID 171346236 (PubChem CID 171346236) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol.
| Compound Name | CID 171346236 |
|---|---|
| PubChem CID | 171346236 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1/C=C1\CNC[C@@]2(C1=O)[C@@H](c1ccccc1C)C1CCCN1[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C33H33N3O2/c1-21-10-3-5-12-23(21)18-24-19-34-20-32(30(24)37)29(25-13-6-4-11-22(25)2)28-16-9-17-36(28)33(32)26-14-7-8-15-27(26)35-31(33)38/h3-8,10-15,18,28-29,34H,9,16-17,19-20H2,1-2H3,(H,35,38)/b24-18+/t28?,29-,32-,33+/m0/s1 |
| InChIKey | DOVZOEGPVNSSAY-IIVSTIOGSA-N |
| XLogP | 4.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|