C42H43N5O4 — CID 71720636
CID 71720636 (PubChem CID 71720636) has the molecular formula C42H43N5O4 and a molecular weight of 681.84 g/mol.
| Compound Name | CID 71720636 |
|---|---|
| PubChem CID | 71720636 |
| Molecular Formula | C42H43N5O4 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1/C=C1\CN(C(=O)C[C@H]2C[C@H]3CCCN3[C@]23C(=O)Nc2ccccc23)C[C@@]2(C[C@H]3CCCN3[C@@]23C(=O)Nc2ccccc23)C1=O |
| InChI | InChI=1S/C42H43N5O4/c1-26-10-2-3-11-27(26)20-28-24-45(36(48)22-29-21-30-12-8-18-46(30)41(29)32-14-4-6-16-34(32)43-38(41)50)25-40(37(28)49)23-31-13-9-19-47(31)42(40)33-15-5-7-17-35(33)44-39(42)51/h2-7,10-11,14-17,20,29-31H,8-9,12-13,18-19,21-25H2,1H3,(H,43,50)(H,44,51)/b28-20+/t29-,30-,31-,40+,41-,42+/m1/s1 |
| InChIKey | JLNJZGPYRYXGAE-IFFGZHMQSA-N |
| XLogP | 5.21 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|