C39H33N3O2S3 — CID 46228362
CID 46228362 (PubChem CID 46228362) has the molecular formula C39H33N3O2S3 and a molecular weight of 671.91 g/mol.
| Compound Name | CID 46228362 |
|---|---|
| PubChem CID | 46228362 |
| Molecular Formula | C39H33N3O2S3 |
| Molecular Weight | 671.91 g/mol |
| Exact Mass | 671.17 |
| IUPAC Name | — |
| SMILES | CN1C/C(=C\c2ccccc2-c2cccs2)C(=O)[C@]2(C1)[C@H](c1ccccc1-c1cccs1)[C@@H]1CSCN1[C@@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C39H33N3O2S3/c1-41-21-26(20-25-10-2-3-11-27(25)33-16-8-18-46-33)36(43)38(23-41)35(29-13-5-4-12-28(29)34-17-9-19-47-34)32-22-45-24-42(32)39(38)30-14-6-7-15-31(30)40-37(39)44/h2-20,32,35H,21-24H2,1H3,(H,40,44)/b26-20+/t32-,35+,38-,39-/m0/s1 |
| InChIKey | NHCASJWGIQKQAP-GXJZMQBDSA-N |
| XLogP | 8.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.91 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|