C20H18N4O4 — CID 7470480
(3R,3aR,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2,3,3a,4,5,6-hexahydroindazole (PubChem CID 7470480) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is (3R,3aR,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2,3,3a,4,5,6-hexahydroindazole.
| Compound Name | (3R,3aR,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2,3,3a,4,5,6-hexahydroindazole |
|---|---|
| PubChem CID | 7470480 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (3R,3aR,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2,3,3a,4,5,6-hexahydroindazole |
| SMILES | O=[N+]([O-])c1cccc(/C=C2\CCC[C@H]3C2=NN[C@H]3c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H18N4O4/c25-23(26)16-7-1-4-13(11-16)10-14-6-3-9-18-19(14)21-22-20(18)15-5-2-8-17(12-15)24(27)28/h1-2,4-5,7-8,10-12,18,20,22H,3,6,9H2/b14-10+/t18-,20-/m0/s1 |
| InChIKey | RGRTYFKGIAIUIH-IWHMKKCGSA-N |
| XLogP | 4.39 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|