C35H37N3O3 — CID 72708466
CID 72708466 (PubChem CID 72708466) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol.
| Compound Name | CID 72708466 |
|---|---|
| PubChem CID | 72708466 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(CCC/C(=C\c3ccccc3)C2=O)[C@@]12C(=O)N(CN1CCOCC1)c1ccccc12 |
| InChI | InChI=1S/C35H37N3O3/c1-36-24-30(27-13-6-3-7-14-27)34(18-10-15-28(32(34)39)23-26-11-4-2-5-12-26)35(36)29-16-8-9-17-31(29)38(33(35)40)25-37-19-21-41-22-20-37/h2-9,11-14,16-17,23,30H,10,15,18-22,24-25H2,1H3/b28-23+/t30-,34+,35+/m0/s1 |
| InChIKey | ZKXRUYBBIZVVIO-WEWGFSBGSA-N |
| XLogP | 5.07 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|