C56H50N4O6 — CID 102052371
CID 102052371 (PubChem CID 102052371) has the molecular formula C56H50N4O6 and a molecular weight of 875.04 g/mol.
| Compound Name | CID 102052371 |
|---|---|
| PubChem CID | 102052371 |
| Molecular Formula | C56H50N4O6 |
| Molecular Weight | 875.04 g/mol |
| Exact Mass | 874.37 |
| IUPAC Name | — |
| SMILES | C#CCN1C(=O)[C@]2(c3ccccc31)N(C)C[C@H](c1ccc([C@@H]3CN(C)[C@]4(C(=O)N(CC#C)c5ccccc54)[C@]34CCc3cc(OC)ccc3C4=O)cc1)[C@]21CCc2cc(OC)ccc2C1=O |
| InChI | InChI=1S/C56H50N4O6/c1-7-29-59-47-15-11-9-13-43(47)55(51(59)63)53(27-25-37-31-39(65-5)21-23-41(37)49(53)61)45(33-57(55)3)35-17-19-36(20-18-35)46-34-58(4)56(44-14-10-12-16-48(44)60(30-8-2)52(56)64)54(46)28-26-38-32-40(66-6)22-24-42(38)50(54)62/h1-2,9-24,31-32,45-46H,25-30,33-34H2,3-6H3/t45-,46+,53+,54-,55+,56- |
| InChIKey | GUPRERFVODLVFH-BBVKXISESA-N |
| XLogP | 7.14 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.04 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|