C22H17NO4 — CID 102143089
(3R,4'R)-5-methoxy-3'-methylidene-4'-phenyl-1-prop-2-ynylspiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 102143089) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is (3R,4'R)-5-methoxy-3'-methylidene-4'-phenyl-1-prop-2-ynylspiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | (3R,4'R)-5-methoxy-3'-methylidene-4'-phenyl-1-prop-2-ynylspiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 102143089 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (3R,4'R)-5-methoxy-3'-methylidene-4'-phenyl-1-prop-2-ynylspiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C#CCN1C(=O)[C@]2(OC(=O)C(=C)[C@H]2c2ccccc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C22H17NO4/c1-4-12-23-18-11-10-16(26-3)13-17(18)22(21(23)25)19(14(2)20(24)27-22)15-8-6-5-7-9-15/h1,5-11,13,19H,2,12H2,3H3/t19-,22-/m0/s1 |
| InChIKey | GAWOZNJQOLQKJN-UGKGYDQZSA-N |
| XLogP | 2.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|