C27H23NO5 — CID 132567761
(2S,4R,5S)-2,5-bis(3-methoxyphenyl)-1'-prop-2-ynylspiro[1,3-dioxolane-4,3'-indole]-2'-one (PubChem CID 132567761) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is (2S,4R,5S)-2,5-bis(3-methoxyphenyl)-1'-prop-2-ynylspiro[1,3-dioxolane-4,3'-indole]-2'-one.
| Compound Name | (2S,4R,5S)-2,5-bis(3-methoxyphenyl)-1'-prop-2-ynylspiro[1,3-dioxolane-4,3'-indole]-2'-one |
|---|---|
| PubChem CID | 132567761 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (2S,4R,5S)-2,5-bis(3-methoxyphenyl)-1'-prop-2-ynylspiro[1,3-dioxolane-4,3'-indole]-2'-one |
| SMILES | C#CCN1C(=O)[C@@]2(O[C@@H](c3cccc(OC)c3)O[C@H]2c2cccc(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C27H23NO5/c1-4-15-28-23-14-6-5-13-22(23)27(26(28)29)24(18-9-7-11-20(16-18)30-2)32-25(33-27)19-10-8-12-21(17-19)31-3/h1,5-14,16-17,24-25H,15H2,2-3H3/t24-,25-,27+/m0/s1 |
| InChIKey | AYPYWPXCBQRPIW-OHSXHVKISA-N |
| XLogP | 4.37 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|